About 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine
6-methyl-5-methylidene-3,4-dihydro-2H-pyridine (PubChem CID 123542747) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine.
Analyze 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine?
The IUPAC name of 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine (CID 123542747) is 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine?
The canonical SMILES for 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine is C=C1CCCN=C1C.
What is the InChIKey of 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine?
The InChIKey is HFKQDOUHORMJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-6-4-3-5-8-7(6)2/h1,3-5H2,2H3.
What are the key properties of 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine?
6-methyl-5-methylidene-3,4-dihydro-2H-pyridine has a molecular weight of 109.17 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-methylidene-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 123542747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).