C7H11N — CID 91101587
6-methyl-3-methylidene-4,5-dihydro-2H-pyridine (PubChem CID 91101587) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 6-methyl-3-methylidene-4,5-dihydro-2H-pyridine.
| Compound Name | 6-methyl-3-methylidene-4,5-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 91101587 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 6-methyl-3-methylidene-4,5-dihydro-2H-pyridine |
| SMILES | C=C1CCC(C)=NC1 |
| InChI | InChI=1S/C7H11N/c1-6-3-4-7(2)8-5-6/h1,3-5H2,2H3 |
| InChIKey | QUEBVPXBSIJRJN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|