C28H49NO — CID 123544106
N-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)oxy]ethyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-amine (PubChem CID 123544106) has the molecular formula C28H49NO and a molecular weight of 415.71 g/mol. Its IUPAC name is N-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)oxy]ethyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-amine.
| Compound Name | N-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)oxy]ethyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 123544106 |
| Molecular Formula | C28H49NO |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 415.38 |
| IUPAC Name | N-[2-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)oxy]ethyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCNCCOC1C(C)CC2CC(C)CC1C2 |
| InChI | InChI=1S/C28H49NO/c1-21(2)9-7-10-22(3)11-8-12-23(4)13-14-29-15-16-30-28-25(6)19-26-17-24(5)18-27(28)20-26/h9,11,13,24-29H,7-8,10,12,14-20H2,1-6H3 |
| InChIKey | BWDGQYZAWJLMQO-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|