C21H19FN4O — CID 123544967
1-(4-fluoro-2-pyrrolidin-1-ylphenyl)-3-phenyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one (PubChem CID 123544967) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-(4-fluoro-2-pyrrolidin-1-ylphenyl)-3-phenyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one.
| Compound Name | 1-(4-fluoro-2-pyrrolidin-1-ylphenyl)-3-phenyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123544967 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-(4-fluoro-2-pyrrolidin-1-ylphenyl)-3-phenyl-2-(1,2,4-triazol-1-yl)prop-2-en-1-one |
| SMILES | O=C(C(=Cc1ccccc1)n1cncn1)c1ccc(F)cc1N1CCCC1 |
| InChI | InChI=1S/C21H19FN4O/c22-17-8-9-18(19(13-17)25-10-4-5-11-25)21(27)20(26-15-23-14-24-26)12-16-6-2-1-3-7-16/h1-3,6-9,12-15H,4-5,10-11H2 |
| InChIKey | ONWRWAOKEMCQKO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|