C17H30BNO — CID 123546571
dimethyl(phenyl)borane;ethane;2-ethyl-1,3-oxazole (PubChem CID 123546571) has the molecular formula C17H30BNO and a molecular weight of 275.25 g/mol. Its IUPAC name is dimethyl(phenyl)borane;ethane;2-ethyl-1,3-oxazole.
| Compound Name | dimethyl(phenyl)borane;ethane;2-ethyl-1,3-oxazole |
|---|---|
| PubChem CID | 123546571 |
| Molecular Formula | C17H30BNO |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | dimethyl(phenyl)borane;ethane;2-ethyl-1,3-oxazole |
| SMILES | CB(C)c1ccccc1.CC.CC.CCc1ncco1 |
| InChI | InChI=1S/C8H11B.C5H7NO.2C2H6/c1-9(2)8-6-4-3-5-7-8;1-2-5-6-3-4-7-5;2*1-2/h3-7H,1-2H3;3-4H,2H2,1H3;2*1-2H3 |
| InChIKey | PAAYVNRHOCPMIM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|