C25H25N5O2S — CID 123547118
4-[[6-[[6-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]amino]-2-pyridinyl]iminomethyl]cyclohexan-1-ol (PubChem CID 123547118) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is 4-[[6-[[6-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]amino]-2-pyridinyl]iminomethyl]cyclohexan-1-ol.
| Compound Name | 4-[[6-[[6-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]amino]-2-pyridinyl]iminomethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123547118 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-[[6-[[6-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]amino]-2-pyridinyl]iminomethyl]cyclohexan-1-ol |
| SMILES | COc1ccc(-c2ccc3nc(Nc4cccc(N=CC5CCC(O)CC5)n4)sc3c2)cn1 |
| InChI | InChI=1S/C25H25N5O2S/c1-32-24-12-8-18(15-27-24)17-7-11-20-21(13-17)33-25(28-20)30-23-4-2-3-22(29-23)26-14-16-5-9-19(31)10-6-16/h2-4,7-8,11-16,19,31H,5-6,9-10H2,1H3,(H,28,29,30) |
| InChIKey | NATDHQDRLLBTAA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|