C22H23FN6O2 — CID 123548123
[(2R,5R)-5-(5-fluoro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-[3-(2-iminoethyldiazenyl)-6-methyl-2-pyridinyl]methanone (PubChem CID 123548123) has the molecular formula C22H23FN6O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is [(2R,5R)-5-(5-fluoro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-[3-(2-iminoethyldiazenyl)-6-methyl-2-pyridinyl]methanone.
| Compound Name | [(2R,5R)-5-(5-fluoro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-[3-(2-iminoethyldiazenyl)-6-methyl-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 123548123 |
| Molecular Formula | C22H23FN6O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(2R,5R)-5-(5-fluoro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-[3-(2-iminoethyldiazenyl)-6-methyl-2-pyridinyl]methanone |
| SMILES | [H]/N=C/C/N=N\c1ccc(C)nc1C(=O)N1C[C@H](c2nc3cc(F)ccc3o2)CC[C@H]1C |
| InChI | InChI=1S/C22H23FN6O2/c1-13-3-7-17(28-25-10-9-24)20(26-13)22(30)29-12-15(5-4-14(29)2)21-27-18-11-16(23)6-8-19(18)31-21/h3,6-9,11,14-15,24H,4-5,10,12H2,1-2H3/b24-9+,28-25-/t14-,15-/m1/s1 |
| InChIKey | ZRTQINIAIDRIMS-KDNUMFJNSA-N |
| XLogP | 4.81 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|