C9H14N2 — CID 123549172
2,2,6-trimethyl-3H-azepin-4-imine (PubChem CID 123549172) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,2,6-trimethyl-3H-azepin-4-imine.
| Compound Name | 2,2,6-trimethyl-3H-azepin-4-imine |
|---|---|
| PubChem CID | 123549172 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2,2,6-trimethyl-3H-azepin-4-imine |
| SMILES | [H]/N=C1\C=C(C)C=NC(C)(C)C1 |
| InChI | InChI=1S/C9H14N2/c1-7-4-8(10)5-9(2,3)11-6-7/h4,6,10H,5H2,1-3H3/b10-8+ |
| InChIKey | OWKNJZKNSALFEB-CSKARUKUSA-N |
| XLogP | 2.21 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|