C12H16N2 — CID 126612267
[7-[(1E)-buta-1,3-dienyl]-4-methyl-3,6-dihydro-2H-azepin-5-yl]methanimine (PubChem CID 126612267) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is [7-[(1E)-buta-1,3-dienyl]-4-methyl-3,6-dihydro-2H-azepin-5-yl]methanimine.
| Compound Name | [7-[(1E)-buta-1,3-dienyl]-4-methyl-3,6-dihydro-2H-azepin-5-yl]methanimine |
|---|---|
| PubChem CID | 126612267 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | [7-[(1E)-buta-1,3-dienyl]-4-methyl-3,6-dihydro-2H-azepin-5-yl]methanimine |
| SMILES | [H]/N=C/C1=C(C)CCN=C(/C=C/C=C)C1 |
| InChI | InChI=1S/C12H16N2/c1-3-4-5-12-8-11(9-13)10(2)6-7-14-12/h3-5,9,13H,1,6-8H2,2H3/b5-4+,13-9+ |
| InChIKey | OFIAYVORYRHPJO-CCKNLQGCSA-N |
| XLogP | 2.93 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|