C14H14N2 — CID 91112646
(8Z)-8-butylidene-6,7-didehydro-3H-benzo[b]azepin-9-imine (PubChem CID 91112646) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (8Z)-8-butylidene-6,7-didehydro-3H-benzo[b]azepin-9-imine.
| Compound Name | (8Z)-8-butylidene-6,7-didehydro-3H-benzo[b]azepin-9-imine |
|---|---|
| PubChem CID | 91112646 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (8Z)-8-butylidene-6,7-didehydro-3H-benzo[b]azepin-9-imine |
| SMILES | [H]/N=C1\C2=C(C#C\C1=C\CCC)C=CCC=N2 |
| InChI | InChI=1S/C14H14N2/c1-2-3-6-11-8-9-12-7-4-5-10-16-14(12)13(11)15/h4,6-7,10,15H,2-3,5H2,1H3/b11-6-,15-13- |
| InChIKey | NRRWBUGTVDKUPL-OLNUMSTCSA-N |
| XLogP | 3.03 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|