C11H14N2 — CID 123986703
1-(6-ethyl-1-azacyclohepta-2,3,5,7-tetraen-2-yl)propan-2-imine (PubChem CID 123986703) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-(6-ethyl-1-azacyclohepta-2,3,5,7-tetraen-2-yl)propan-2-imine.
| Compound Name | 1-(6-ethyl-1-azacyclohepta-2,3,5,7-tetraen-2-yl)propan-2-imine |
|---|---|
| PubChem CID | 123986703 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(6-ethyl-1-azacyclohepta-2,3,5,7-tetraen-2-yl)propan-2-imine |
| SMILES | [H]/N=C(\C)CC1=C=CC=C(CC)C=N1 |
| InChI | InChI=1S/C11H14N2/c1-3-10-5-4-6-11(13-8-10)7-9(2)12/h4-5,8,12H,3,7H2,1-2H3/b12-9+ |
| InChIKey | IRKWXJAPFKXVEB-FMIVXFBMSA-N |
| XLogP | 2.88 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|