C27H25BF9NO4 — CID 123552172
1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 123552172) has the molecular formula C27H25BF9NO4 and a molecular weight of 609.29 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 123552172 |
| Molecular Formula | C27H25BF9NO4 |
| Molecular Weight | 609.29 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | CC1(C)OB(c2ccc(C(F)(F)F)cc2C2CCC3C(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)OC(=O)N23)OC1(C)C |
| InChI | InChI=1S/C27H25BF9NO4/c1-23(2)24(3,4)42-28(41-23)18-6-5-14(25(29,30)31)12-17(18)19-7-8-20-21(40-22(39)38(19)20)13-9-15(26(32,33)34)11-16(10-13)27(35,36)37/h5-6,9-12,19-21H,7-8H2,1-4H3 |
| InChIKey | OKFJVWOPODHYQW-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.29 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|