C7H12N2 — CID 123554614
2-methyliminohexa-3,5-dien-1-amine (PubChem CID 123554614) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 2-methyliminohexa-3,5-dien-1-amine.
| Compound Name | 2-methyliminohexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 123554614 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2-methyliminohexa-3,5-dien-1-amine |
| SMILES | C=CC=C/C(CN)=N/C |
| InChI | InChI=1S/C7H12N2/c1-3-4-5-7(6-8)9-2/h3-5H,1,6,8H2,2H3/b5-4?,9-7- |
| InChIKey | JRFKQWPRUIBJNA-HFOWNTLMSA-N |
| XLogP | 0.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|