C12H20O — CID 123558453
2-methyl-5-(1-propoxyethyl)cyclohexa-1,3-diene (PubChem CID 123558453) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-methyl-5-(1-propoxyethyl)cyclohexa-1,3-diene.
| Compound Name | 2-methyl-5-(1-propoxyethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123558453 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2-methyl-5-(1-propoxyethyl)cyclohexa-1,3-diene |
| SMILES | CCCOC(C)C1C=CC(C)=CC1 |
| InChI | InChI=1S/C12H20O/c1-4-9-13-11(3)12-7-5-10(2)6-8-12/h5-7,11-12H,4,8-9H2,1-3H3 |
| InChIKey | ONIKKLVQKYDIPZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |