C29H37F3O — CID 143773153
(2E,7Z,11Z,15E)-7,8,16-trifluoro-18-methyl-6,9,10,13,14,17-hexamethylidene-19-propan-2-yloxynonadeca-2,7,11,15-tetraene (PubChem CID 143773153) has the molecular formula C29H37F3O and a molecular weight of 458.61 g/mol. Its IUPAC name is (2E,7Z,11Z,15E)-7,8,16-trifluoro-18-methyl-6,9,10,13,14,17-hexamethylidene-19-propan-2-yloxynonadeca-2,7,11,15-tetraene.
| Compound Name | (2E,7Z,11Z,15E)-7,8,16-trifluoro-18-methyl-6,9,10,13,14,17-hexamethylidene-19-propan-2-yloxynonadeca-2,7,11,15-tetraene |
|---|---|
| PubChem CID | 143773153 |
| Molecular Formula | C29H37F3O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | (2E,7Z,11Z,15E)-7,8,16-trifluoro-18-methyl-6,9,10,13,14,17-hexamethylidene-19-propan-2-yloxynonadeca-2,7,11,15-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)CC/C=C/C)C(=C)/C=C(/F)C(=C)C(C)COC(C)C |
| InChI | InChI=1S/C29H37F3O/c1-11-12-13-14-22(6)28(31)29(32)26(10)21(5)16-15-20(4)23(7)17-27(30)25(9)24(8)18-33-19(2)3/h11-12,15-17,19,24H,4-7,9-10,13-14,18H2,1-3,8H3/b12-11+,16-15-,27-17+,29-28- |
| InChIKey | NZWMIYJWPDUIOL-JNSQNBBASA-N |
| XLogP | 9.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|