C12H19FO — CID 134376263
6-(2-fluoroethoxy)-2-propan-2-ylcyclohepta-1,3-diene (PubChem CID 134376263) has the molecular formula C12H19FO and a molecular weight of 198.28 g/mol. Its IUPAC name is 6-(2-fluoroethoxy)-2-propan-2-ylcyclohepta-1,3-diene.
| Compound Name | 6-(2-fluoroethoxy)-2-propan-2-ylcyclohepta-1,3-diene |
|---|---|
| PubChem CID | 134376263 |
| Molecular Formula | C12H19FO |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 6-(2-fluoroethoxy)-2-propan-2-ylcyclohepta-1,3-diene |
| SMILES | CC(C)C1=CCC(OCCF)CC=C1 |
| InChI | InChI=1S/C12H19FO/c1-10(2)11-4-3-5-12(7-6-11)14-9-8-13/h3-4,6,10,12H,5,7-9H2,1-2H3 |
| InChIKey | LMEVTJVWIBHBKW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |