C28H35F3O — CID 143772556
(6Z,10Z,14E)-6,7,14-trifluoro-17-methyl-5,8,9,12,13,16-hexamethylidene-18-propan-2-yloxyoctadeca-1,6,10,14-tetraene (PubChem CID 143772556) has the molecular formula C28H35F3O and a molecular weight of 444.58 g/mol. Its IUPAC name is (6Z,10Z,14E)-6,7,14-trifluoro-17-methyl-5,8,9,12,13,16-hexamethylidene-18-propan-2-yloxyoctadeca-1,6,10,14-tetraene.
| Compound Name | (6Z,10Z,14E)-6,7,14-trifluoro-17-methyl-5,8,9,12,13,16-hexamethylidene-18-propan-2-yloxyoctadeca-1,6,10,14-tetraene |
|---|---|
| PubChem CID | 143772556 |
| Molecular Formula | C28H35F3O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | (6Z,10Z,14E)-6,7,14-trifluoro-17-methyl-5,8,9,12,13,16-hexamethylidene-18-propan-2-yloxyoctadeca-1,6,10,14-tetraene |
| SMILES | C=CCCC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C/C(=C)C(=C)/C(F)=C\C(=C)C(C)COC(C)C |
| InChI | InChI=1S/C28H35F3O/c1-11-12-13-21(6)27(30)28(31)25(10)20(5)15-14-19(4)24(9)26(29)16-22(7)23(8)17-32-18(2)3/h11,14-16,18,23H,1,4-7,9-10,12-13,17H2,2-3,8H3/b15-14-,26-16+,28-27- |
| InChIKey | OOXQYNBXJQAJDE-IWQRKRQQSA-N |
| XLogP | 8.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|