C29H36F4O — CID 143772467
(2E,7Z,11Z,15Z)-7,8,15,16-tetrafluoro-6,9,10,13,14,17-hexamethylidene-18-(2-methylpropoxy)nonadeca-2,7,11,15-tetraene (PubChem CID 143772467) has the molecular formula C29H36F4O and a molecular weight of 476.60 g/mol. Its IUPAC name is (2E,7Z,11Z,15Z)-7,8,15,16-tetrafluoro-6,9,10,13,14,17-hexamethylidene-18-(2-methylpropoxy)nonadeca-2,7,11,15-tetraene.
| Compound Name | (2E,7Z,11Z,15Z)-7,8,15,16-tetrafluoro-6,9,10,13,14,17-hexamethylidene-18-(2-methylpropoxy)nonadeca-2,7,11,15-tetraene |
|---|---|
| PubChem CID | 143772467 |
| Molecular Formula | C29H36F4O |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (2E,7Z,11Z,15Z)-7,8,15,16-tetrafluoro-6,9,10,13,14,17-hexamethylidene-18-(2-methylpropoxy)nonadeca-2,7,11,15-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(C)OCC(C)C)C(=C)/C(F)=C(/F)C(=C)CC/C=C/C |
| InChI | InChI=1S/C29H36F4O/c1-11-12-13-14-21(6)26(30)27(31)22(7)19(4)15-16-20(5)23(8)28(32)29(33)24(9)25(10)34-17-18(2)3/h11-12,15-16,18,25H,4-9,13-14,17H2,1-3,10H3/b12-11+,16-15-,27-26-,29-28- |
| InChIKey | PSGFEXJRRHSQRY-YBCJXCNUSA-N |
| XLogP | 9.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|