C25H30F4O — CID 143772477
(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-2-methyl-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)pentadeca-1,3,7,11-tetraene (PubChem CID 143772477) has the molecular formula C25H30F4O and a molecular weight of 422.51 g/mol. Its IUPAC name is (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-2-methyl-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)pentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-2-methyl-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)pentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772477 |
| Molecular Formula | C25H30F4O |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-2-methyl-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)pentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(C)OCC(C)C)C(=C)/C(F)=C(/F)C(=C)C |
| InChI | InChI=1S/C25H30F4O/c1-14(2)13-30-21(10)20(9)25(29)24(28)19(8)17(6)12-11-16(5)18(7)23(27)22(26)15(3)4/h11-12,14,21H,3,5-9,13H2,1-2,4,10H3/b12-11-,23-22-,25-24- |
| InChIKey | IJLPZMGGORAAEN-DVUHRYKSSA-N |
| XLogP | 8.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|