C27H29N5O — CID 123559237
9-(3-aminophenyl)-3-ethyl-N-(4-morpholin-4-ylphenyl)-4H-pyrido[3,4-b]azepin-2-amine (PubChem CID 123559237) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is 9-(3-aminophenyl)-3-ethyl-N-(4-morpholin-4-ylphenyl)-4H-pyrido[3,4-b]azepin-2-amine.
| Compound Name | 9-(3-aminophenyl)-3-ethyl-N-(4-morpholin-4-ylphenyl)-4H-pyrido[3,4-b]azepin-2-amine |
|---|---|
| PubChem CID | 123559237 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 9-(3-aminophenyl)-3-ethyl-N-(4-morpholin-4-ylphenyl)-4H-pyrido[3,4-b]azepin-2-amine |
| SMILES | CCC1=C(Nc2ccc(N3CCOCC3)cc2)N=c2c(-c3cccc(N)c3)nccc2=CC1 |
| InChI | InChI=1S/C27H29N5O/c1-2-19-6-7-20-12-13-29-25(21-4-3-5-22(28)18-21)26(20)31-27(19)30-23-8-10-24(11-9-23)32-14-16-33-17-15-32/h3-5,7-13,18,30H,2,6,14-17,28H2,1H3 |
| InChIKey | TYZXKOIRGSYPTC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|