About 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine
2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine (PubChem CID 123560419) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine.
Analyze 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine?
The IUPAC name of 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine (CID 123560419) is 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine.
What is the SMILES notation for 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine?
The canonical SMILES for 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine is CCC1C=NC(=C2CC2)CC1.
What is the InChIKey of 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine?
The InChIKey is PPCWYFLNAIMJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-2-8-3-6-10(11-7-8)9-4-5-9/h7-8H,2-6H2,1H3.
What are the key properties of 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine?
2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine has a molecular weight of 149.24 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylidene-5-ethyl-4,5-dihydro-3H-pyridine is sourced from PubChem (CID 123560419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).