C27H32F3NO4 — CID 123561447
N-[4-ethyl-1-(3-hydroxyoxiran-2-yl)cyclohexyl]-4-(3-hydroxypropyl)-3-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 123561447) has the molecular formula C27H32F3NO4 and a molecular weight of 491.55 g/mol. Its IUPAC name is N-[4-ethyl-1-(3-hydroxyoxiran-2-yl)cyclohexyl]-4-(3-hydroxypropyl)-3-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-ethyl-1-(3-hydroxyoxiran-2-yl)cyclohexyl]-4-(3-hydroxypropyl)-3-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 123561447 |
| Molecular Formula | C27H32F3NO4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-[4-ethyl-1-(3-hydroxyoxiran-2-yl)cyclohexyl]-4-(3-hydroxypropyl)-3-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCC1CCC(NC(=O)c2ccc(CCCO)c(-c3cccc(C(F)(F)F)c3)c2)(C2OC2O)CC1 |
| InChI | InChI=1S/C27H32F3NO4/c1-2-17-10-12-26(13-11-17,23-25(34)35-23)31-24(33)20-9-8-18(6-4-14-32)22(16-20)19-5-3-7-21(15-19)27(28,29)30/h3,5,7-9,15-17,23,25,32,34H,2,4,6,10-14H2,1H3,(H,31,33) |
| InChIKey | FBBQXCFXJBEDBN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|