C16H22BClO2 — CID 123564454
2-[1-chloro-2-(3-ethylphenyl)ethyl]-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborole (PubChem CID 123564454) has the molecular formula C16H22BClO2 and a molecular weight of 292.62 g/mol. Its IUPAC name is 2-[1-chloro-2-(3-ethylphenyl)ethyl]-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborole.
| Compound Name | 2-[1-chloro-2-(3-ethylphenyl)ethyl]-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 123564454 |
| Molecular Formula | C16H22BClO2 |
| Molecular Weight | 292.62 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[1-chloro-2-(3-ethylphenyl)ethyl]-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborole |
| SMILES | CCc1cccc(CC(Cl)B2OC3CCCCC3O2)c1 |
| InChI | InChI=1S/C16H22BClO2/c1-2-12-6-5-7-13(10-12)11-16(18)17-19-14-8-3-4-9-15(14)20-17/h5-7,10,14-16H,2-4,8-9,11H2,1H3 |
| InChIKey | GLDRMQYJFPLLLN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|