C13H16F6O4 — CID 123565742
5,5,5-trifluoro-4-hydroxy-2-[(4-hydroxycyclohexyl)methyl]-4-(trifluoromethyl)pent-2-enoic acid (PubChem CID 123565742) has the molecular formula C13H16F6O4 and a molecular weight of 350.26 g/mol. Its IUPAC name is 5,5,5-trifluoro-4-hydroxy-2-[(4-hydroxycyclohexyl)methyl]-4-(trifluoromethyl)pent-2-enoic acid.
| Compound Name | 5,5,5-trifluoro-4-hydroxy-2-[(4-hydroxycyclohexyl)methyl]-4-(trifluoromethyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 123565742 |
| Molecular Formula | C13H16F6O4 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 5,5,5-trifluoro-4-hydroxy-2-[(4-hydroxycyclohexyl)methyl]-4-(trifluoromethyl)pent-2-enoic acid |
| SMILES | O=C(O)C(=CC(O)(C(F)(F)F)C(F)(F)F)CC1CCC(O)CC1 |
| InChI | InChI=1S/C13H16F6O4/c14-12(15,16)11(23,13(17,18)19)6-8(10(21)22)5-7-1-3-9(20)4-2-7/h6-7,9,20,23H,1-5H2,(H,21,22) |
| InChIKey | QXZCLJVXNPQUKE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|