C10H14N2O — CID 123566091
5-(hexa-2,4-dien-3-yloxymethyl)-1H-pyrazole (PubChem CID 123566091) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-(hexa-2,4-dien-3-yloxymethyl)-1H-pyrazole.
| Compound Name | 5-(hexa-2,4-dien-3-yloxymethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 123566091 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 5-(hexa-2,4-dien-3-yloxymethyl)-1H-pyrazole |
| SMILES | CC=CC(=CC)OCc1ccn[nH]1 |
| InChI | InChI=1S/C10H14N2O/c1-3-5-10(4-2)13-8-9-6-7-11-12-9/h3-7H,8H2,1-2H3,(H,11,12) |
| InChIKey | AVWVIUUCYDDZGP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|