C24H29BO2 — CID 123567481
2-(1,2,5,6,8a,12a-hexahydrobenzo[g]phenanthren-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123567481) has the molecular formula C24H29BO2 and a molecular weight of 360.31 g/mol. Its IUPAC name is 2-(1,2,5,6,8a,12a-hexahydrobenzo[g]phenanthren-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,2,5,6,8a,12a-hexahydrobenzo[g]phenanthren-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123567481 |
| Molecular Formula | C24H29BO2 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-(1,2,5,6,8a,12a-hexahydrobenzo[g]phenanthren-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CC3=C(CC2)C2=C(C=CC4C=CC=CC24)CC3)OC1(C)C |
| InChI | InChI=1S/C24H29BO2/c1-23(2)24(3,4)27-25(26-23)19-13-14-21-18(15-19)12-11-17-10-9-16-7-5-6-8-20(16)22(17)21/h5-10,15-16,20H,11-14H2,1-4H3 |
| InChIKey | TXEXUVXSKSVXHZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|