C30H39BO2 — CID 162419251
2-(2,7-ditert-butyl-8,10b-dihydropyren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162419251) has the molecular formula C30H39BO2 and a molecular weight of 442.45 g/mol. Its IUPAC name is 2-(2,7-ditert-butyl-8,10b-dihydropyren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2,7-ditert-butyl-8,10b-dihydropyren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162419251 |
| Molecular Formula | C30H39BO2 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 2-(2,7-ditert-butyl-8,10b-dihydropyren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)C1=CC2=CC=C3CC(C(C)(C)C)=CC4=C3C2C(=C1)C(B1OC(C)(C)C(C)(C)O1)=C4 |
| InChI | InChI=1S/C30H39BO2/c1-27(2,3)21-13-18-11-12-19-14-22(28(4,5)6)17-23-24(16-20(15-21)25(18)26(19)23)31-32-29(7,8)30(9,10)33-31/h11-12,14-17,26H,13H2,1-10H3 |
| InChIKey | IOKJYYZHOMYVQE-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|