C41H84O7 — CID 123567720
1,3-bis[1,3-bis(2,4,4-trimethylpentan-2-yloxy)propan-2-yloxy]propan-2-ol (PubChem CID 123567720) has the molecular formula C41H84O7 and a molecular weight of 689.12 g/mol. Its IUPAC name is 1,3-bis[1,3-bis(2,4,4-trimethylpentan-2-yloxy)propan-2-yloxy]propan-2-ol.
| Compound Name | 1,3-bis[1,3-bis(2,4,4-trimethylpentan-2-yloxy)propan-2-yloxy]propan-2-ol |
|---|---|
| PubChem CID | 123567720 |
| Molecular Formula | C41H84O7 |
| Molecular Weight | 689.12 g/mol |
| Exact Mass | 688.62 |
| IUPAC Name | 1,3-bis[1,3-bis(2,4,4-trimethylpentan-2-yloxy)propan-2-yloxy]propan-2-ol |
| SMILES | CC(C)(C)CC(C)(C)OCC(COC(C)(C)CC(C)(C)C)OCC(O)COC(COC(C)(C)CC(C)(C)C)COC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C41H84O7/c1-34(2,3)27-38(13,14)45-23-32(24-46-39(15,16)28-35(4,5)6)43-21-31(42)22-44-33(25-47-40(17,18)29-36(7,8)9)26-48-41(19,20)30-37(10,11)12/h31-33,42H,21-30H2,1-20H3 |
| InChIKey | FUXYJLUDNNFGSO-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.12 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |