C16H34O5 — CID 139970467
1-[2-(2,4,4-trimethylpentan-2-ylperoxy)butan-2-ylperoxy]butan-2-ol (PubChem CID 139970467) has the molecular formula C16H34O5 and a molecular weight of 306.44 g/mol. Its IUPAC name is 1-[2-(2,4,4-trimethylpentan-2-ylperoxy)butan-2-ylperoxy]butan-2-ol.
| Compound Name | 1-[2-(2,4,4-trimethylpentan-2-ylperoxy)butan-2-ylperoxy]butan-2-ol |
|---|---|
| PubChem CID | 139970467 |
| Molecular Formula | C16H34O5 |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 1-[2-(2,4,4-trimethylpentan-2-ylperoxy)butan-2-ylperoxy]butan-2-ol |
| SMILES | CCC(O)COOC(C)(CC)OOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H34O5/c1-9-13(17)11-18-20-16(8,10-2)21-19-15(6,7)12-14(3,4)5/h13,17H,9-12H2,1-8H3 |
| InChIKey | WIVYDFHZFQZETM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|