C19H40O5 — CID 139970495
4-methyl-1-[4-methyl-2-(2,3,3-trimethylbutan-2-ylperoxy)pentan-2-yl]peroxypentan-2-ol (PubChem CID 139970495) has the molecular formula C19H40O5 and a molecular weight of 348.52 g/mol. Its IUPAC name is 4-methyl-1-[4-methyl-2-(2,3,3-trimethylbutan-2-ylperoxy)pentan-2-yl]peroxypentan-2-ol.
| Compound Name | 4-methyl-1-[4-methyl-2-(2,3,3-trimethylbutan-2-ylperoxy)pentan-2-yl]peroxypentan-2-ol |
|---|---|
| PubChem CID | 139970495 |
| Molecular Formula | C19H40O5 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | 4-methyl-1-[4-methyl-2-(2,3,3-trimethylbutan-2-ylperoxy)pentan-2-yl]peroxypentan-2-ol |
| SMILES | CC(C)CC(O)COOC(C)(CC(C)C)OOC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O5/c1-14(2)11-16(20)13-21-23-19(10,12-15(3)4)24-22-18(8,9)17(5,6)7/h14-16,20H,11-13H2,1-10H3 |
| InChIKey | SLLUFAUFFMKHIJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|