C18H38O4 — CID 139945246
2,2-bis(2,3-dimethylbutan-2-ylperoxy)-4-methylpentane (PubChem CID 139945246) has the molecular formula C18H38O4 and a molecular weight of 318.50 g/mol. Its IUPAC name is 2,2-bis(2,3-dimethylbutan-2-ylperoxy)-4-methylpentane.
| Compound Name | 2,2-bis(2,3-dimethylbutan-2-ylperoxy)-4-methylpentane |
|---|---|
| PubChem CID | 139945246 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 2,2-bis(2,3-dimethylbutan-2-ylperoxy)-4-methylpentane |
| SMILES | CC(C)CC(C)(OOC(C)(C)C(C)C)OOC(C)(C)C(C)C |
| InChI | InChI=1S/C18H38O4/c1-13(2)12-18(11,21-19-16(7,8)14(3)4)22-20-17(9,10)15(5)6/h13-15H,12H2,1-11H3 |
| InChIKey | RNUQZCPVXSOUBY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|