C34H28N6O4 — CID 123571630
3-[amino-[3-[[3-[amino(phenyl)carbamoyl]benzoyl]amino]phenyl]carbamoyl]-N-phenylbenzamide (PubChem CID 123571630) has the molecular formula C34H28N6O4 and a molecular weight of 584.64 g/mol. Its IUPAC name is 3-[amino-[3-[[3-[amino(phenyl)carbamoyl]benzoyl]amino]phenyl]carbamoyl]-N-phenylbenzamide.
| Compound Name | 3-[amino-[3-[[3-[amino(phenyl)carbamoyl]benzoyl]amino]phenyl]carbamoyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 123571630 |
| Molecular Formula | C34H28N6O4 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 3-[amino-[3-[[3-[amino(phenyl)carbamoyl]benzoyl]amino]phenyl]carbamoyl]-N-phenylbenzamide |
| SMILES | NN(C(=O)c1cccc(C(=O)Nc2cccc(N(N)C(=O)c3cccc(C(=O)Nc4ccccc4)c3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C34H28N6O4/c35-39(29-17-5-2-6-18-29)33(43)25-12-8-11-24(21-25)32(42)38-28-16-9-19-30(22-28)40(36)34(44)26-13-7-10-23(20-26)31(41)37-27-14-3-1-4-15-27/h1-22H,35-36H2,(H,37,41)(H,38,42) |
| InChIKey | CLUYWOKOYRBIMV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|