C27H24N4O3 — CID 123994342
3-[amino(phenyl)carbamoyl]-5-[anilino(hydroxy)methyl]-N-phenylbenzamide (PubChem CID 123994342) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3-[amino(phenyl)carbamoyl]-5-[anilino(hydroxy)methyl]-N-phenylbenzamide.
| Compound Name | 3-[amino(phenyl)carbamoyl]-5-[anilino(hydroxy)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 123994342 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 3-[amino(phenyl)carbamoyl]-5-[anilino(hydroxy)methyl]-N-phenylbenzamide |
| SMILES | NN(C(=O)c1cc(C(=O)Nc2ccccc2)cc(C(O)Nc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C27H24N4O3/c28-31(24-14-8-3-9-15-24)27(34)21-17-19(25(32)29-22-10-4-1-5-11-22)16-20(18-21)26(33)30-23-12-6-2-7-13-23/h1-18,25,29,32H,28H2,(H,30,33) |
| InChIKey | PGJGZEWTLPTXPD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|