C15H15NO8 — CID 123576644
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[(2-oxo-1H-quinolin-8-yl)oxy]oxane-2-carboxylic acid (PubChem CID 123576644) has the molecular formula C15H15NO8 and a molecular weight of 337.28 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[(2-oxo-1H-quinolin-8-yl)oxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[(2-oxo-1H-quinolin-8-yl)oxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 123576644 |
| Molecular Formula | C15H15NO8 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[(2-oxo-1H-quinolin-8-yl)oxy]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1OC(Oc2cccc3ccc(=O)[nH]c23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H15NO8/c17-8-5-4-6-2-1-3-7(9(6)16-8)23-15-12(20)10(18)11(19)13(24-15)14(21)22/h1-5,10-13,15,18-20H,(H,16,17)(H,21,22)/t10-,11-,12+,13-,15?/m0/s1 |
| InChIKey | ITQHQPYYDHOEHN-HXMBFPRCSA-N |
| XLogP | -1.20 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |