C16H19NO8 — CID 90783370
4-methoxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-quinolin-2-one (PubChem CID 90783370) has the molecular formula C16H19NO8 and a molecular weight of 353.33 g/mol. Its IUPAC name is 4-methoxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-quinolin-2-one.
| Compound Name | 4-methoxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 90783370 |
| Molecular Formula | C16H19NO8 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-methoxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-quinolin-2-one |
| SMILES | COc1cc(=O)[nH]c2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cccc12 |
| InChI | InChI=1S/C16H19NO8/c1-23-9-5-11(19)17-12-7(9)3-2-4-8(12)24-16-15(22)14(21)13(20)10(6-18)25-16/h2-5,10,13-16,18,20-22H,6H2,1H3,(H,17,19)/t10-,13-,14+,15-,16-/m1/s1 |
| InChIKey | AZMXGLGJNSTXST-LMXXTMHSSA-N |
| XLogP | -1.28 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |