C21H22ClN5O3S — CID 123579042
N'-[1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethyl]-3-imino-2-(methanesulfonamido)propanimidamide (PubChem CID 123579042) has the molecular formula C21H22ClN5O3S and a molecular weight of 459.96 g/mol. Its IUPAC name is N'-[1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethyl]-3-imino-2-(methanesulfonamido)propanimidamide.
| Compound Name | N'-[1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethyl]-3-imino-2-(methanesulfonamido)propanimidamide |
|---|---|
| PubChem CID | 123579042 |
| Molecular Formula | C21H22ClN5O3S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | N'-[1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethyl]-3-imino-2-(methanesulfonamido)propanimidamide |
| SMILES | [H]/N=C/C(NS(C)(=O)=O)/C(N)=N/C(C)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H22ClN5O3S/c1-13(25-20(24)17(12-23)26-31(2,29)30)18-11-14-7-6-10-16(22)19(14)21(28)27(18)15-8-4-3-5-9-15/h3-13,17,23,26H,1-2H3,(H2,24,25)/b23-12+ |
| InChIKey | XFBQYVVLGNNDPL-FSJBWODESA-N |
| XLogP | 2.63 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|