C27H37ClN3O+ — CID 123581254
1-[[1-(4-chlorophenyl)-6-octan-4-ylpyrrolo[2,3-c]pyridin-6-ium-3-yl]methyl]piperidin-4-ol (PubChem CID 123581254) has the molecular formula C27H37ClN3O+ and a molecular weight of 455.07 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)-6-octan-4-ylpyrrolo[2,3-c]pyridin-6-ium-3-yl]methyl]piperidin-4-ol.
| Compound Name | 1-[[1-(4-chlorophenyl)-6-octan-4-ylpyrrolo[2,3-c]pyridin-6-ium-3-yl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 123581254 |
| Molecular Formula | C27H37ClN3O+ |
| Molecular Weight | 455.07 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)-6-octan-4-ylpyrrolo[2,3-c]pyridin-6-ium-3-yl]methyl]piperidin-4-ol |
| SMILES | CCCCC(CCC)[n+]1ccc2c(CN3CCC(O)CC3)cn(-c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C27H37ClN3O/c1-3-5-7-23(6-4-2)30-17-14-26-21(18-29-15-12-25(32)13-16-29)19-31(27(26)20-30)24-10-8-22(28)9-11-24/h8-11,14,17,19-20,23,25,32H,3-7,12-13,15-16,18H2,1-2H3/q+1 |
| InChIKey | QUHAPPYGTIBJKL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 32.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.07 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|