C26H31ClN2O2 — CID 134108064
1-[[5-[2-(4-chlorophenyl)ethoxy]-1-(cyclopropylmethyl)indol-3-yl]methyl]piperidin-4-ol (PubChem CID 134108064) has the molecular formula C26H31ClN2O2 and a molecular weight of 439.00 g/mol. Its IUPAC name is 1-[[5-[2-(4-chlorophenyl)ethoxy]-1-(cyclopropylmethyl)indol-3-yl]methyl]piperidin-4-ol.
| Compound Name | 1-[[5-[2-(4-chlorophenyl)ethoxy]-1-(cyclopropylmethyl)indol-3-yl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 134108064 |
| Molecular Formula | C26H31ClN2O2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[[5-[2-(4-chlorophenyl)ethoxy]-1-(cyclopropylmethyl)indol-3-yl]methyl]piperidin-4-ol |
| SMILES | OC1CCN(Cc2cn(CC3CC3)c3ccc(OCCc4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C26H31ClN2O2/c27-22-5-3-19(4-6-22)11-14-31-24-7-8-26-25(15-24)21(18-29(26)16-20-1-2-20)17-28-12-9-23(30)10-13-28/h3-8,15,18,20,23,30H,1-2,9-14,16-17H2 |
| InChIKey | WVAUSDKPNHGHFU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |