C37H42ClN3O5 — CID 85470460
tert-butyl 4-[3-[4-[5-(4-chlorophenoxy)-1-(cyclopropylmethyl)indole-3-carbonyl]phenoxy]propyl]piperazine-1-carboxylate (PubChem CID 85470460) has the molecular formula C37H42ClN3O5 and a molecular weight of 644.21 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-[5-(4-chlorophenoxy)-1-(cyclopropylmethyl)indole-3-carbonyl]phenoxy]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-[5-(4-chlorophenoxy)-1-(cyclopropylmethyl)indole-3-carbonyl]phenoxy]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 85470460 |
| Molecular Formula | C37H42ClN3O5 |
| Molecular Weight | 644.21 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | tert-butyl 4-[3-[4-[5-(4-chlorophenoxy)-1-(cyclopropylmethyl)indole-3-carbonyl]phenoxy]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCOc2ccc(C(=O)c3cn(CC4CC4)c4ccc(Oc5ccc(Cl)cc5)cc34)cc2)CC1 |
| InChI | InChI=1S/C37H42ClN3O5/c1-37(2,3)46-36(43)40-20-18-39(19-21-40)17-4-22-44-29-11-7-27(8-12-29)35(42)33-25-41(24-26-5-6-26)34-16-15-31(23-32(33)34)45-30-13-9-28(38)10-14-30/h7-16,23,25-26H,4-6,17-22,24H2,1-3H3 |
| InChIKey | YAPLGIATMUUIRT-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.21 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|