C21H32S — CID 123583090
2,4,6-tricyclopentylcyclohex-2-ene-1-thione (PubChem CID 123583090) has the molecular formula C21H32S and a molecular weight of 316.55 g/mol. Its IUPAC name is 2,4,6-tricyclopentylcyclohex-2-ene-1-thione.
| Compound Name | 2,4,6-tricyclopentylcyclohex-2-ene-1-thione |
|---|---|
| PubChem CID | 123583090 |
| Molecular Formula | C21H32S |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2,4,6-tricyclopentylcyclohex-2-ene-1-thione |
| SMILES | S=C1C(C2CCCC2)=CC(C2CCCC2)CC1C1CCCC1 |
| InChI | InChI=1S/C21H32S/c22-21-19(16-9-3-4-10-16)13-18(15-7-1-2-8-15)14-20(21)17-11-5-6-12-17/h13,15-18,20H,1-12,14H2 |
| InChIKey | JQRZFUCUURVKRY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|