C26H25ClF3N5O5S2 — CID 123586985
2-[5-[[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-ethanimidoylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-pyrrolidin-1-ylsulfonylacetamide (PubChem CID 123586985) has the molecular formula C26H25ClF3N5O5S2 and a molecular weight of 644.10 g/mol. Its IUPAC name is 2-[5-[[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-ethanimidoylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-pyrrolidin-1-ylsulfonylacetamide.
| Compound Name | 2-[5-[[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-ethanimidoylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-pyrrolidin-1-ylsulfonylacetamide |
|---|---|
| PubChem CID | 123586985 |
| Molecular Formula | C26H25ClF3N5O5S2 |
| Molecular Weight | 644.10 g/mol |
| Exact Mass | 643.09 |
| IUPAC Name | 2-[5-[[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-ethanimidoylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-pyrrolidin-1-ylsulfonylacetamide |
| SMILES | [H]/N=C(\C)c1cc(C=C2SC(=O)N(CC(=O)NS(=O)(=O)N3CCCC3)C2=O)ccc1NCc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C26H25ClF3N5O5S2/c1-15(31)19-10-16(4-7-21(19)32-13-17-5-6-18(27)12-20(17)26(28,29)30)11-22-24(37)35(25(38)41-22)14-23(36)33-42(39,40)34-8-2-3-9-34/h4-7,10-12,31-32H,2-3,8-9,13-14H2,1H3,(H,33,36)/b22-11?,31-15+ |
| InChIKey | UHHNZEUJWGQWGU-CXNIJWRKSA-N |
| XLogP | 4.85 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.10 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|