C27H28ClF3N4O3S — CID 123906853
ethyl 2-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-5-[[2,4-dioxo-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]benzenecarboximidate (PubChem CID 123906853) has the molecular formula C27H28ClF3N4O3S and a molecular weight of 581.06 g/mol. Its IUPAC name is ethyl 2-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-5-[[2,4-dioxo-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]benzenecarboximidate.
| Compound Name | ethyl 2-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-5-[[2,4-dioxo-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]benzenecarboximidate |
|---|---|
| PubChem CID | 123906853 |
| Molecular Formula | C27H28ClF3N4O3S |
| Molecular Weight | 581.06 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | ethyl 2-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-5-[[2,4-dioxo-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidin-5-ylidene]methyl]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1cc(C=C2SC(=O)N(CCN3CCCC3)C2=O)ccc1NCc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C27H28ClF3N4O3S/c1-2-38-24(32)20-13-17(14-23-25(36)35(26(37)39-23)12-11-34-9-3-4-10-34)5-8-22(20)33-16-18-6-7-19(28)15-21(18)27(29,30)31/h5-8,13-15,32-33H,2-4,9-12,16H2,1H3/b23-14?,32-24- |
| InChIKey | XCJQNNYWUVURKM-XBTNGOQPSA-N |
| XLogP | 6.46 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.06 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|