C23H22ClF3N4O3S — CID 153337610
S-[(Z)-3-[(2-amino-2-oxoethyl)-methylamino]-1-[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-ethanimidoylphenyl]-3-oxoprop-1-en-2-yl] methanethioate (PubChem CID 153337610) has the molecular formula C23H22ClF3N4O3S and a molecular weight of 526.97 g/mol. Its IUPAC name is S-[(Z)-3-[(2-amino-2-oxoethyl)-methylamino]-1-[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-ethanimidoylphenyl]-3-oxoprop-1-en-2-yl] methanethioate.
| Compound Name | S-[(Z)-3-[(2-amino-2-oxoethyl)-methylamino]-1-[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-ethanimidoylphenyl]-3-oxoprop-1-en-2-yl] methanethioate |
|---|---|
| PubChem CID | 153337610 |
| Molecular Formula | C23H22ClF3N4O3S |
| Molecular Weight | 526.97 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | S-[(Z)-3-[(2-amino-2-oxoethyl)-methylamino]-1-[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-ethanimidoylphenyl]-3-oxoprop-1-en-2-yl] methanethioate |
| SMILES | [H]/N=C(\C)c1cc(/C=C(\SC=O)C(=O)N(C)CC(N)=O)ccc1NCc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C23H22ClF3N4O3S/c1-13(28)17-7-14(8-20(35-12-32)22(34)31(2)11-21(29)33)3-6-19(17)30-10-15-4-5-16(24)9-18(15)23(25,26)27/h3-9,12,28,30H,10-11H2,1-2H3,(H2,29,33)/b20-8-,28-13+ |
| InChIKey | OAIJZNIBTPWOAE-KGVLPSPVSA-N |
| XLogP | 4.57 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.97 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|