C28H31ClF3N5O3S — CID 88874431
(Z)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-(methyliminomethyl)phenyl]-N-formyl-2-sulfanylprop-2-enamide (PubChem CID 88874431) has the molecular formula C28H31ClF3N5O3S and a molecular weight of 610.10 g/mol. Its IUPAC name is (Z)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-(methyliminomethyl)phenyl]-N-formyl-2-sulfanylprop-2-enamide.
| Compound Name | (Z)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-(methyliminomethyl)phenyl]-N-formyl-2-sulfanylprop-2-enamide |
|---|---|
| PubChem CID | 88874431 |
| Molecular Formula | C28H31ClF3N5O3S |
| Molecular Weight | 610.10 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | (Z)-N-[2-(4-acetylpiperazin-1-yl)ethyl]-3-[4-[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]-3-(methyliminomethyl)phenyl]-N-formyl-2-sulfanylprop-2-enamide |
| SMILES | C/N=C/c1cc(/C=C(\S)C(=O)N(C=O)CCN2CCN(C(C)=O)CC2)ccc1NCc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C28H31ClF3N5O3S/c1-19(39)36-10-7-35(8-11-36)9-12-37(18-38)27(40)26(41)14-20-3-6-25(22(13-20)16-33-2)34-17-21-4-5-23(29)15-24(21)28(30,31)32/h3-6,13-16,18,34,41H,7-12,17H2,1-2H3/b26-14-,33-16+ |
| InChIKey | JACLWXNPLGMAGJ-HPPOTICESA-N |
| XLogP | 4.44 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.10 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|