C24H26FN5O — CID 123592669
1-[3-[[6-[2-[4-(2-fluoropropan-2-yl)phenyl]ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-ol (PubChem CID 123592669) has the molecular formula C24H26FN5O and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[3-[[6-[2-[4-(2-fluoropropan-2-yl)phenyl]ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-ol.
| Compound Name | 1-[3-[[6-[2-[4-(2-fluoropropan-2-yl)phenyl]ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123592669 |
| Molecular Formula | C24H26FN5O |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-[3-[[6-[2-[4-(2-fluoropropan-2-yl)phenyl]ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-ol |
| SMILES | C=CC(O)N1CCC(Nc2ncnc3[nH]c(C#Cc4ccc(C(C)(C)F)cc4)cc23)C1 |
| InChI | InChI=1S/C24H26FN5O/c1-4-21(31)30-12-11-19(14-30)29-23-20-13-18(28-22(20)26-15-27-23)10-7-16-5-8-17(9-6-16)24(2,3)25/h4-6,8-9,13,15,19,21,31H,1,11-12,14H2,2-3H3,(H2,26,27,28,29) |
| InChIKey | MPHNAJYYLFPQIX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|