C9H13N — CID 123592729
N-(6-methylhepta-1,3,5-trien-2-yl)methanimine (PubChem CID 123592729) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is N-(6-methylhepta-1,3,5-trien-2-yl)methanimine.
| Compound Name | N-(6-methylhepta-1,3,5-trien-2-yl)methanimine |
|---|---|
| PubChem CID | 123592729 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N-(6-methylhepta-1,3,5-trien-2-yl)methanimine |
| SMILES | C=NC(=C)C=CC=C(C)C |
| InChI | InChI=1S/C9H13N/c1-8(2)6-5-7-9(3)10-4/h5-7H,3-4H2,1-2H3 |
| InChIKey | HBJCRRKWPHMUCA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|