C14H29N — CID 123592820
2-ethyl-N,5,7-trimethylnon-8-en-1-amine (PubChem CID 123592820) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is 2-ethyl-N,5,7-trimethylnon-8-en-1-amine.
| Compound Name | 2-ethyl-N,5,7-trimethylnon-8-en-1-amine |
|---|---|
| PubChem CID | 123592820 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 2-ethyl-N,5,7-trimethylnon-8-en-1-amine |
| SMILES | C=CC(C)CC(C)CCC(CC)CNC |
| InChI | InChI=1S/C14H29N/c1-6-12(3)10-13(4)8-9-14(7-2)11-15-5/h6,12-15H,1,7-11H2,2-5H3 |
| InChIKey | SAXHLUHGMZBOSJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|