C11H22FN — CID 123595869
5-fluoro-N,8-dimethylnon-5-en-2-amine (PubChem CID 123595869) has the molecular formula C11H22FN and a molecular weight of 187.30 g/mol. Its IUPAC name is 5-fluoro-N,8-dimethylnon-5-en-2-amine.
| Compound Name | 5-fluoro-N,8-dimethylnon-5-en-2-amine |
|---|---|
| PubChem CID | 123595869 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 5-fluoro-N,8-dimethylnon-5-en-2-amine |
| SMILES | CNC(C)CCC(F)=CCC(C)C |
| InChI | InChI=1S/C11H22FN/c1-9(2)5-7-11(12)8-6-10(3)13-4/h7,9-10,13H,5-6,8H2,1-4H3 |
| InChIKey | XBNMUIGEXUDIKA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |