C16H26O5 — CID 123597709
dimethyl 2-[[(2S,3S)-3-heptyloxiran-2-yl]methylidene]butanedioate (PubChem CID 123597709) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is dimethyl 2-[[(2S,3S)-3-heptyloxiran-2-yl]methylidene]butanedioate.
| Compound Name | dimethyl 2-[[(2S,3S)-3-heptyloxiran-2-yl]methylidene]butanedioate |
|---|---|
| PubChem CID | 123597709 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | dimethyl 2-[[(2S,3S)-3-heptyloxiran-2-yl]methylidene]butanedioate |
| SMILES | CCCCCCC[C@@H]1O[C@H]1C=C(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H26O5/c1-4-5-6-7-8-9-13-14(21-13)10-12(16(18)20-3)11-15(17)19-2/h10,13-14H,4-9,11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | URBJAYHSFYCUJH-KBPBESRZSA-N |
| XLogP | 2.78 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|