C11H19FO2S — CID 123598096
5-ethyl-4-fluoro-2-methyl-7-methylsulfonylhepta-2,4-diene (PubChem CID 123598096) has the molecular formula C11H19FO2S and a molecular weight of 234.34 g/mol. Its IUPAC name is 5-ethyl-4-fluoro-2-methyl-7-methylsulfonylhepta-2,4-diene.
| Compound Name | 5-ethyl-4-fluoro-2-methyl-7-methylsulfonylhepta-2,4-diene |
|---|---|
| PubChem CID | 123598096 |
| Molecular Formula | C11H19FO2S |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 5-ethyl-4-fluoro-2-methyl-7-methylsulfonylhepta-2,4-diene |
| SMILES | CCC(CCS(C)(=O)=O)=C(F)C=C(C)C |
| InChI | InChI=1S/C11H19FO2S/c1-5-10(6-7-15(4,13)14)11(12)8-9(2)3/h8H,5-7H2,1-4H3 |
| InChIKey | UZEVSCGWSZHEMK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|